C19H25N3O4 — CID 168562256
methyl 1-(2-hydroxyethyl)-5-oxo-4-(4-piperidin-3-ylanilino)-2H-pyrrole-3-carboxylate (PubChem CID 168562256) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-5-oxo-4-(4-piperidin-3-ylanilino)-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-(4-piperidin-3-ylanilino)-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168562256 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-(4-piperidin-3-ylanilino)-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(C3CCCNC3)cc2)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C19H25N3O4/c1-26-19(25)16-12-22(9-10-23)18(24)17(16)21-15-6-4-13(5-7-15)14-3-2-8-20-11-14/h4-7,14,20-21,23H,2-3,8-12H2,1H3 |
| InChIKey | FOBBLRCDTGQXSV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |