C14H12BrCl2FN2O4 — CID 168562278
methyl 4-(6-bromo-2,4-dichloro-3-fluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168562278) has the molecular formula C14H12BrCl2FN2O4 and a molecular weight of 442.07 g/mol. Its IUPAC name is methyl 4-(6-bromo-2,4-dichloro-3-fluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(6-bromo-2,4-dichloro-3-fluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168562278 |
| Molecular Formula | C14H12BrCl2FN2O4 |
| Molecular Weight | 442.07 g/mol |
| Exact Mass | 439.93 |
| IUPAC Name | methyl 4-(6-bromo-2,4-dichloro-3-fluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2c(Br)cc(Cl)c(F)c2Cl)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C14H12BrCl2FN2O4/c1-24-14(23)6-5-20(2-3-21)13(22)11(6)19-12-7(15)4-8(16)10(18)9(12)17/h4,19,21H,2-3,5H2,1H3 |
| InChIKey | BDXNAJWGRQKZKE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.07 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|