C14H13BrF2N2O5 — CID 168564682
methyl 4-(5-bromo-3,4-difluoro-2-hydroxyanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168564682) has the molecular formula C14H13BrF2N2O5 and a molecular weight of 407.17 g/mol. Its IUPAC name is methyl 4-(5-bromo-3,4-difluoro-2-hydroxyanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(5-bromo-3,4-difluoro-2-hydroxyanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168564682 |
| Molecular Formula | C14H13BrF2N2O5 |
| Molecular Weight | 407.17 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | methyl 4-(5-bromo-3,4-difluoro-2-hydroxyanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2cc(Br)c(F)c(F)c2O)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C14H13BrF2N2O5/c1-24-14(23)6-5-19(2-3-20)13(22)11(6)18-8-4-7(15)9(16)10(17)12(8)21/h4,18,20-21H,2-3,5H2,1H3 |
| InChIKey | CCXORAUETSJAGC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.17 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|