C14H13BrF2N2O4 — CID 168562341
methyl 4-(2-bromo-3,5-difluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168562341) has the molecular formula C14H13BrF2N2O4 and a molecular weight of 391.17 g/mol. Its IUPAC name is methyl 4-(2-bromo-3,5-difluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(2-bromo-3,5-difluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168562341 |
| Molecular Formula | C14H13BrF2N2O4 |
| Molecular Weight | 391.17 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | methyl 4-(2-bromo-3,5-difluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2cc(F)cc(F)c2Br)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C14H13BrF2N2O4/c1-23-14(22)8-6-19(2-3-20)13(21)12(8)18-10-5-7(16)4-9(17)11(10)15/h4-5,18,20H,2-3,6H2,1H3 |
| InChIKey | WNLDUAZABMZOIY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|