C14H14ClFN2O4 — CID 168564566
methyl 4-(2-chloro-3-fluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168564566) has the molecular formula C14H14ClFN2O4 and a molecular weight of 328.73 g/mol. Its IUPAC name is methyl 4-(2-chloro-3-fluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(2-chloro-3-fluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168564566 |
| Molecular Formula | C14H14ClFN2O4 |
| Molecular Weight | 328.73 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | methyl 4-(2-chloro-3-fluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2cccc(F)c2Cl)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C14H14ClFN2O4/c1-22-14(21)8-7-18(5-6-19)13(20)12(8)17-10-4-2-3-9(16)11(10)15/h2-4,17,19H,5-7H2,1H3 |
| InChIKey | QSFHAKBIABXDMY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.73 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |