C17H22FN3O5 — CID 168563981
methyl 4-[3-fluoro-2-(2-methoxyethylamino)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168563981) has the molecular formula C17H22FN3O5 and a molecular weight of 367.38 g/mol. Its IUPAC name is methyl 4-[3-fluoro-2-(2-methoxyethylamino)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-[3-fluoro-2-(2-methoxyethylamino)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168563981 |
| Molecular Formula | C17H22FN3O5 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | methyl 4-[3-fluoro-2-(2-methoxyethylamino)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COCCNc1c(F)cccc1NC1=C(C(=O)OC)CN(CCO)C1=O |
| InChI | InChI=1S/C17H22FN3O5/c1-25-9-6-19-15-12(18)4-3-5-13(15)20-14-11(17(24)26-2)10-21(7-8-22)16(14)23/h3-5,19-20,22H,6-10H2,1-2H3 |
| InChIKey | OYHPBZUUINKMBF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|