C15H14FN3O4 — CID 168563184
methyl 4-(2-cyano-6-fluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168563184) has the molecular formula C15H14FN3O4 and a molecular weight of 319.29 g/mol. Its IUPAC name is methyl 4-(2-cyano-6-fluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(2-cyano-6-fluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168563184 |
| Molecular Formula | C15H14FN3O4 |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | methyl 4-(2-cyano-6-fluoroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2c(F)cccc2C#N)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C15H14FN3O4/c1-23-15(22)10-8-19(5-6-20)14(21)13(10)18-12-9(7-17)3-2-4-11(12)16/h2-4,18,20H,5-6,8H2,1H3 |
| InChIKey | BKEWHVUTBUYBPM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |