C15H14IN3O4 — CID 168561154
methyl 4-(2-cyano-4-iodoanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168561154) has the molecular formula C15H14IN3O4 and a molecular weight of 427.20 g/mol. Its IUPAC name is methyl 4-(2-cyano-4-iodoanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(2-cyano-4-iodoanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168561154 |
| Molecular Formula | C15H14IN3O4 |
| Molecular Weight | 427.20 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | methyl 4-(2-cyano-4-iodoanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(I)cc2C#N)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C15H14IN3O4/c1-23-15(22)11-8-19(4-5-20)14(21)13(11)18-12-3-2-10(16)6-9(12)7-17/h2-3,6,18,20H,4-5,8H2,1H3 |
| InChIKey | AEYLVHSSCROKQP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|