C15H18N4O6 — CID 168562941
methyl 1-(2-hydroxyethyl)-4-[2-(methylamino)-4-nitroanilino]-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168562941) has the molecular formula C15H18N4O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-4-[2-(methylamino)-4-nitroanilino]-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-4-[2-(methylamino)-4-nitroanilino]-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168562941 |
| Molecular Formula | C15H18N4O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-4-[2-(methylamino)-4-nitroanilino]-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | CNc1cc([N+](=O)[O-])ccc1NC1=C(C(=O)OC)CN(CCO)C1=O |
| InChI | InChI=1S/C15H18N4O6/c1-16-12-7-9(19(23)24)3-4-11(12)17-13-10(15(22)25-2)8-18(5-6-20)14(13)21/h3-4,7,16-17,20H,5-6,8H2,1-2H3 |
| InChIKey | UEKHNEPFEHOJMX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|