C14H15N3O9S — CID 168561653
4-[[1-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-2H-pyrrol-4-yl]amino]-3-nitrobenzenesulfonic acid (PubChem CID 168561653) has the molecular formula C14H15N3O9S and a molecular weight of 401.35 g/mol. Its IUPAC name is 4-[[1-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-2H-pyrrol-4-yl]amino]-3-nitrobenzenesulfonic acid.
| Compound Name | 4-[[1-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-2H-pyrrol-4-yl]amino]-3-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 168561653 |
| Molecular Formula | C14H15N3O9S |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 4-[[1-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-2H-pyrrol-4-yl]amino]-3-nitrobenzenesulfonic acid |
| SMILES | COC(=O)C1=C(Nc2ccc(S(=O)(=O)O)cc2[N+](=O)[O-])C(=O)N(CCO)C1 |
| InChI | InChI=1S/C14H15N3O9S/c1-26-14(20)9-7-16(4-5-18)13(19)12(9)15-10-3-2-8(27(23,24)25)6-11(10)17(21)22/h2-3,6,15,18H,4-5,7H2,1H3,(H,23,24,25) |
| InChIKey | POEARGRUGWWGLD-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 176.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|