C18H22BrN3O7 — CID 168561475
methyl 4-(4-bromo-5-butoxy-2-nitroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168561475) has the molecular formula C18H22BrN3O7 and a molecular weight of 472.29 g/mol. Its IUPAC name is methyl 4-(4-bromo-5-butoxy-2-nitroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(4-bromo-5-butoxy-2-nitroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168561475 |
| Molecular Formula | C18H22BrN3O7 |
| Molecular Weight | 472.29 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | methyl 4-(4-bromo-5-butoxy-2-nitroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | CCCCOc1cc(NC2=C(C(=O)OC)CN(CCO)C2=O)c([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C18H22BrN3O7/c1-3-4-7-29-15-9-13(14(22(26)27)8-12(15)19)20-16-11(18(25)28-2)10-21(5-6-23)17(16)24/h8-9,20,23H,3-7,10H2,1-2H3 |
| InChIKey | UCMKXQIFMSBCLT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|