C15H16FN3O6 — CID 168561590
methyl 4-(5-fluoro-2-methyl-4-nitroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168561590) has the molecular formula C15H16FN3O6 and a molecular weight of 353.31 g/mol. Its IUPAC name is methyl 4-(5-fluoro-2-methyl-4-nitroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(5-fluoro-2-methyl-4-nitroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168561590 |
| Molecular Formula | C15H16FN3O6 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | methyl 4-(5-fluoro-2-methyl-4-nitroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2cc(F)c([N+](=O)[O-])cc2C)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C15H16FN3O6/c1-8-5-12(19(23)24)10(16)6-11(8)17-13-9(15(22)25-2)7-18(3-4-20)14(13)21/h5-6,17,20H,3-4,7H2,1-2H3 |
| InChIKey | ZBFDNJAAISQCDF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|