C17H19N3O8 — CID 168563617
methyl 1-(2-hydroxyethyl)-4-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168563617) has the molecular formula C17H19N3O8 and a molecular weight of 393.35 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-4-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-4-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168563617 |
| Molecular Formula | C17H19N3O8 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-4-[(7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)amino]-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2cc3c(cc2[N+](=O)[O-])OCCCO3)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C17H19N3O8/c1-26-17(23)10-9-19(3-4-21)16(22)15(10)18-11-7-13-14(8-12(11)20(24)25)28-6-2-5-27-13/h7-8,18,21H,2-6,9H2,1H3 |
| InChIKey | NRDJFYKOIHNEQI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|