C15H14F3N3O7 — CID 168562320
methyl 1-(2-hydroxyethyl)-4-[2-hydroxy-4-nitro-5-(trifluoromethyl)anilino]-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168562320) has the molecular formula C15H14F3N3O7 and a molecular weight of 405.29 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-4-[2-hydroxy-4-nitro-5-(trifluoromethyl)anilino]-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-4-[2-hydroxy-4-nitro-5-(trifluoromethyl)anilino]-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168562320 |
| Molecular Formula | C15H14F3N3O7 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-4-[2-hydroxy-4-nitro-5-(trifluoromethyl)anilino]-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2cc(C(F)(F)F)c([N+](=O)[O-])cc2O)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C15H14F3N3O7/c1-28-14(25)7-6-20(2-3-22)13(24)12(7)19-9-4-8(15(16,17)18)10(21(26)27)5-11(9)23/h4-5,19,22-23H,2-3,6H2,1H3 |
| InChIKey | NCJROSHJAXLTTC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|