C15H13F3N4O8 — CID 168562088
methyl 4-[2,6-dinitro-4-(trifluoromethyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168562088) has the molecular formula C15H13F3N4O8 and a molecular weight of 434.28 g/mol. Its IUPAC name is methyl 4-[2,6-dinitro-4-(trifluoromethyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-[2,6-dinitro-4-(trifluoromethyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168562088 |
| Molecular Formula | C15H13F3N4O8 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | methyl 4-[2,6-dinitro-4-(trifluoromethyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])C(=O)N(CCO)C1 |
| InChI | InChI=1S/C15H13F3N4O8/c1-30-14(25)8-6-20(2-3-23)13(24)11(8)19-12-9(21(26)27)4-7(15(16,17)18)5-10(12)22(28)29/h4-5,19,23H,2-3,6H2,1H3 |
| InChIKey | MZGNEKKZYQJYCM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 165.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|