C15H14IN3O8 — CID 168562257
2-[[1-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-2H-pyrrol-4-yl]amino]-3-iodo-5-nitrobenzoic acid (PubChem CID 168562257) has the molecular formula C15H14IN3O8 and a molecular weight of 491.19 g/mol. Its IUPAC name is 2-[[1-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-2H-pyrrol-4-yl]amino]-3-iodo-5-nitrobenzoic acid.
| Compound Name | 2-[[1-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-2H-pyrrol-4-yl]amino]-3-iodo-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 168562257 |
| Molecular Formula | C15H14IN3O8 |
| Molecular Weight | 491.19 g/mol |
| Exact Mass | 490.98 |
| IUPAC Name | 2-[[1-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-2H-pyrrol-4-yl]amino]-3-iodo-5-nitrobenzoic acid |
| SMILES | COC(=O)C1=C(Nc2c(I)cc([N+](=O)[O-])cc2C(=O)O)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C15H14IN3O8/c1-27-15(24)9-6-18(2-3-20)13(21)12(9)17-11-8(14(22)23)4-7(19(25)26)5-10(11)16/h4-5,17,20H,2-3,6H2,1H3,(H,22,23) |
| InChIKey | OLLCPIYXPOHRAD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 159.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|