C20H18ClN3O6S — CID 168565080
methyl 4-[3-(4-chlorophenyl)sulfanyl-5-nitroanilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168565080) has the molecular formula C20H18ClN3O6S and a molecular weight of 463.90 g/mol. Its IUPAC name is methyl 4-[3-(4-chlorophenyl)sulfanyl-5-nitroanilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-[3-(4-chlorophenyl)sulfanyl-5-nitroanilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168565080 |
| Molecular Formula | C20H18ClN3O6S |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | methyl 4-[3-(4-chlorophenyl)sulfanyl-5-nitroanilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2cc(Sc3ccc(Cl)cc3)cc([N+](=O)[O-])c2)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C20H18ClN3O6S/c1-30-20(27)17-11-23(6-7-25)19(26)18(17)22-13-8-14(24(28)29)10-16(9-13)31-15-4-2-12(21)3-5-15/h2-5,8-10,22,25H,6-7,11H2,1H3 |
| InChIKey | YQKMQZZDJKQXEO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|