C21H21N3O8S — CID 168562794
methyl 4-(3-benzylsulfonyl-5-nitroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168562794) has the molecular formula C21H21N3O8S and a molecular weight of 475.48 g/mol. Its IUPAC name is methyl 4-(3-benzylsulfonyl-5-nitroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(3-benzylsulfonyl-5-nitroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168562794 |
| Molecular Formula | C21H21N3O8S |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | methyl 4-(3-benzylsulfonyl-5-nitroanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2cc([N+](=O)[O-])cc(S(=O)(=O)Cc3ccccc3)c2)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C21H21N3O8S/c1-32-21(27)18-12-23(7-8-25)20(26)19(18)22-15-9-16(24(28)29)11-17(10-15)33(30,31)13-14-5-3-2-4-6-14/h2-6,9-11,22,25H,7-8,12-13H2,1H3 |
| InChIKey | UBYQQBRSDOLIKT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|