C23H20N4O6S — CID 168565161
methyl 1-(2-hydroxyethyl)-4-[4-nitro-2-(4-phenyl-1,3-thiazol-2-yl)anilino]-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168565161) has the molecular formula C23H20N4O6S and a molecular weight of 480.50 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-4-[4-nitro-2-(4-phenyl-1,3-thiazol-2-yl)anilino]-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-4-[4-nitro-2-(4-phenyl-1,3-thiazol-2-yl)anilino]-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168565161 |
| Molecular Formula | C23H20N4O6S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-4-[4-nitro-2-(4-phenyl-1,3-thiazol-2-yl)anilino]-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc([N+](=O)[O-])cc2-c2nc(-c3ccccc3)cs2)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C23H20N4O6S/c1-33-23(30)17-12-26(9-10-28)22(29)20(17)24-18-8-7-15(27(31)32)11-16(18)21-25-19(13-34-21)14-5-3-2-4-6-14/h2-8,11,13,24,28H,9-10,12H2,1H3 |
| InChIKey | DRFJOQNNZBGNSV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|