C17H23N3O4 — CID 168561437
methyl 1-(2-hydroxyethyl)-5-oxo-4-[2-(propan-2-ylamino)anilino]-2H-pyrrole-3-carboxylate (PubChem CID 168561437) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-5-oxo-4-[2-(propan-2-ylamino)anilino]-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-[2-(propan-2-ylamino)anilino]-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168561437 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-[2-(propan-2-ylamino)anilino]-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccccc2NC(C)C)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C17H23N3O4/c1-11(2)18-13-6-4-5-7-14(13)19-15-12(17(23)24-3)10-20(8-9-21)16(15)22/h4-7,11,18-19,21H,8-10H2,1-3H3 |
| InChIKey | DSEZSFJDGCKETI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |