C16H16F4N2O5 — CID 168564139
methyl 1-(2-hydroxyethyl)-5-oxo-4-[2-(1,1,2,2-tetrafluoroethoxy)anilino]-2H-pyrrole-3-carboxylate (PubChem CID 168564139) has the molecular formula C16H16F4N2O5 and a molecular weight of 392.31 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-5-oxo-4-[2-(1,1,2,2-tetrafluoroethoxy)anilino]-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-[2-(1,1,2,2-tetrafluoroethoxy)anilino]-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168564139 |
| Molecular Formula | C16H16F4N2O5 |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-[2-(1,1,2,2-tetrafluoroethoxy)anilino]-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccccc2OC(F)(F)C(F)F)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C16H16F4N2O5/c1-26-14(25)9-8-22(6-7-23)13(24)12(9)21-10-4-2-3-5-11(10)27-16(19,20)15(17)18/h2-5,15,21,23H,6-8H2,1H3 |
| InChIKey | QQTIKYGHTYARGP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|