C15H17FN2O5 — CID 168565157
methyl 4-(4-fluoro-2-methoxyanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168565157) has the molecular formula C15H17FN2O5 and a molecular weight of 324.31 g/mol. Its IUPAC name is methyl 4-(4-fluoro-2-methoxyanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(4-fluoro-2-methoxyanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168565157 |
| Molecular Formula | C15H17FN2O5 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | methyl 4-(4-fluoro-2-methoxyanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(F)cc2OC)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C15H17FN2O5/c1-22-12-7-9(16)3-4-11(12)17-13-10(15(21)23-2)8-18(5-6-19)14(13)20/h3-4,7,17,19H,5-6,8H2,1-2H3 |
| InChIKey | OGONOYLSRUSHKH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |