C17H23N3O6S — CID 168565715
methyl 1-(2-hydroxyethyl)-5-oxo-4-[4-(propylsulfamoyl)anilino]-2H-pyrrole-3-carboxylate (PubChem CID 168565715) has the molecular formula C17H23N3O6S and a molecular weight of 397.45 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-5-oxo-4-[4-(propylsulfamoyl)anilino]-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-[4-(propylsulfamoyl)anilino]-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168565715 |
| Molecular Formula | C17H23N3O6S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-5-oxo-4-[4-(propylsulfamoyl)anilino]-2H-pyrrole-3-carboxylate |
| SMILES | CCCNS(=O)(=O)c1ccc(NC2=C(C(=O)OC)CN(CCO)C2=O)cc1 |
| InChI | InChI=1S/C17H23N3O6S/c1-3-8-18-27(24,25)13-6-4-12(5-7-13)19-15-14(17(23)26-2)11-20(9-10-21)16(15)22/h4-7,18-19,21H,3,8-11H2,1-2H3 |
| InChIKey | CHUNYXWLDHPJFB-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |