C16H19N3O7S — CID 168561648
methyl 4-[4-(acetylsulfamoyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168561648) has the molecular formula C16H19N3O7S and a molecular weight of 397.41 g/mol. Its IUPAC name is methyl 4-[4-(acetylsulfamoyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-[4-(acetylsulfamoyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168561648 |
| Molecular Formula | C16H19N3O7S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | methyl 4-[4-(acetylsulfamoyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(S(=O)(=O)NC(C)=O)cc2)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C16H19N3O7S/c1-10(21)18-27(24,25)12-5-3-11(4-6-12)17-14-13(16(23)26-2)9-19(7-8-20)15(14)22/h3-6,17,20H,7-9H2,1-2H3,(H,18,21) |
| InChIKey | VUJSPIRGUFCGQY-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |