C19H22F2N2O4Si — CID 168562621
methyl 4-[2,3-difluoro-4-(2-trimethylsilylethynyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168562621) has the molecular formula C19H22F2N2O4Si and a molecular weight of 408.48 g/mol. Its IUPAC name is methyl 4-[2,3-difluoro-4-(2-trimethylsilylethynyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-[2,3-difluoro-4-(2-trimethylsilylethynyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168562621 |
| Molecular Formula | C19H22F2N2O4Si |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | methyl 4-[2,3-difluoro-4-(2-trimethylsilylethynyl)anilino]-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(C#C[Si](C)(C)C)c(F)c2F)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C19H22F2N2O4Si/c1-27-19(26)13-11-23(8-9-24)18(25)17(13)22-14-6-5-12(15(20)16(14)21)7-10-28(2,3)4/h5-6,22,24H,8-9,11H2,1-4H3 |
| InChIKey | QJJZKDIACDTIOA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|