C15H16BrN3O5 — CID 168562940
methyl 4-(2-bromo-6-carbamoylanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168562940) has the molecular formula C15H16BrN3O5 and a molecular weight of 398.21 g/mol. Its IUPAC name is methyl 4-(2-bromo-6-carbamoylanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(2-bromo-6-carbamoylanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168562940 |
| Molecular Formula | C15H16BrN3O5 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | methyl 4-(2-bromo-6-carbamoylanilino)-1-(2-hydroxyethyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2c(Br)cccc2C(N)=O)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C15H16BrN3O5/c1-24-15(23)9-7-19(5-6-20)14(22)12(9)18-11-8(13(17)21)3-2-4-10(11)16/h2-4,18,20H,5-7H2,1H3,(H2,17,21) |
| InChIKey | ZEFPNRVAHUDRPH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |