C22H22N2O6 — CID 168562665
methyl 1-(2-hydroxyethyl)-4-[2-(4-methoxybenzoyl)anilino]-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 168562665) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-4-[2-(4-methoxybenzoyl)anilino]-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | methyl 1-(2-hydroxyethyl)-4-[2-(4-methoxybenzoyl)anilino]-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 168562665 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-4-[2-(4-methoxybenzoyl)anilino]-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccccc2C(=O)c2ccc(OC)cc2)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C22H22N2O6/c1-29-15-9-7-14(8-10-15)20(26)16-5-3-4-6-18(16)23-19-17(22(28)30-2)13-24(11-12-25)21(19)27/h3-10,23,25H,11-13H2,1-2H3 |
| InChIKey | BUGNRDZXLNKWLW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|