C22H26N2O5 — CID 168566177
dimethyl (E)-2-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]anilino]but-2-enedioate (PubChem CID 168566177) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is dimethyl (E)-2-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168566177 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | dimethyl (E)-2-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(CCNCC(O)c2ccccc2)cc1)C(=O)OC |
| InChI | InChI=1S/C22H26N2O5/c1-28-21(26)14-19(22(27)29-2)24-18-10-8-16(9-11-18)12-13-23-15-20(25)17-6-4-3-5-7-17/h3-11,14,20,23-25H,12-13,15H2,1-2H3/b19-14+ |
| InChIKey | SSDAROOJQFOHBD-XMHGGMMESA-N |
| XLogP | 2.19 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|