C21H20N4O6 — CID 168568057
dimethyl (E)-2-[3-(3-ethoxycarbonylpyrazolo[1,5-a]pyrimidin-7-yl)anilino]but-2-enedioate (PubChem CID 168568057) has the molecular formula C21H20N4O6 and a molecular weight of 424.41 g/mol. Its IUPAC name is dimethyl (E)-2-[3-(3-ethoxycarbonylpyrazolo[1,5-a]pyrimidin-7-yl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-(3-ethoxycarbonylpyrazolo[1,5-a]pyrimidin-7-yl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568057 |
| Molecular Formula | C21H20N4O6 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | dimethyl (E)-2-[3-(3-ethoxycarbonylpyrazolo[1,5-a]pyrimidin-7-yl)anilino]but-2-enedioate |
| SMILES | CCOC(=O)c1cnn2c(-c3cccc(N/C(=C/C(=O)OC)C(=O)OC)c3)ccnc12 |
| InChI | InChI=1S/C21H20N4O6/c1-4-31-20(27)15-12-23-25-17(8-9-22-19(15)25)13-6-5-7-14(10-13)24-16(21(28)30-3)11-18(26)29-2/h5-12,24H,4H2,1-3H3/b16-11+ |
| InChIKey | RCFQYXQWBSDWFW-LFIBNONCSA-N |
| XLogP | 2.21 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|