C16H12N4O3 — CID 169354842
ethyl 7-(3-isocyanatophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 169354842) has the molecular formula C16H12N4O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is ethyl 7-(3-isocyanatophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 7-(3-isocyanatophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 169354842 |
| Molecular Formula | C16H12N4O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | ethyl 7-(3-isocyanatophenyl)pyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)c1cnn2c(-c3cccc(N=C=O)c3)ccnc12 |
| InChI | InChI=1S/C16H12N4O3/c1-2-23-16(22)13-9-19-20-14(6-7-17-15(13)20)11-4-3-5-12(8-11)18-10-21/h3-9H,2H2,1H3 |
| InChIKey | GTNKVVQKMUAIJX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 85.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|