C16H17N3O5 — CID 168569636
dimethyl (E)-2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]but-2-enedioate (PubChem CID 168569636) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is dimethyl (E)-2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569636 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | dimethyl (E)-2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)anilino]but-2-enedioate |
| SMILES | CCc1noc(-c2ccc(N/C(=C/C(=O)OC)C(=O)OC)cc2)n1 |
| InChI | InChI=1S/C16H17N3O5/c1-4-13-18-15(24-19-13)10-5-7-11(8-6-10)17-12(16(21)23-3)9-14(20)22-2/h5-9,17H,4H2,1-3H3/b12-9+ |
| InChIKey | WQVSILYYKFYZKR-FMIVXFBMSA-N |
| XLogP | 1.94 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|