C17H19NO5 — CID 168570574
dimethyl (E)-2-[3-(3-hydroxy-3-methylbut-1-ynyl)anilino]but-2-enedioate (PubChem CID 168570574) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is dimethyl (E)-2-[3-(3-hydroxy-3-methylbut-1-ynyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-(3-hydroxy-3-methylbut-1-ynyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168570574 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | dimethyl (E)-2-[3-(3-hydroxy-3-methylbut-1-ynyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cccc(C#CC(C)(C)O)c1)C(=O)OC |
| InChI | InChI=1S/C17H19NO5/c1-17(2,21)9-8-12-6-5-7-13(10-12)18-14(16(20)23-4)11-15(19)22-3/h5-7,10-11,18,21H,1-4H3/b14-11+ |
| InChIKey | AJYWRZQFNYGNOD-SDNWHVSQSA-N |
| XLogP | 1.45 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|