C26H26FN5O2 — CID 168571192
2-[2-[[4-(cyclohexylmethoxymethyl)-3-fluorophenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571192) has the molecular formula C26H26FN5O2 and a molecular weight of 459.53 g/mol. Its IUPAC name is 2-[2-[[4-(cyclohexylmethoxymethyl)-3-fluorophenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[4-(cyclohexylmethoxymethyl)-3-fluorophenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571192 |
| Molecular Formula | C26H26FN5O2 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 2-[2-[[4-(cyclohexylmethoxymethyl)-3-fluorophenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2ccc(COCC3CCCCC3)c(F)c2)[nH]c1=O |
| InChI | InChI=1S/C26H26FN5O2/c27-23-13-19(11-12-21(23)17-34-16-18-7-3-1-4-8-18)15-29-32-26-30-24(20-9-5-2-6-10-20)22(14-28)25(33)31-26/h2,5-6,9-13,15,18H,1,3-4,7-8,16-17H2,(H2,30,31,32,33) |
| InChIKey | QNVMLGMADYXEKY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|