C13H15N3O3S — CID 168573836
2-[(6-hydroxy-3-methoxy-2,4-dimethylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168573836) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-[(6-hydroxy-3-methoxy-2,4-dimethylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[(6-hydroxy-3-methoxy-2,4-dimethylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168573836 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-[(6-hydroxy-3-methoxy-2,4-dimethylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1c(C)cc(O)c(C=NN=C2NC(=O)CS2)c1C |
| InChI | InChI=1S/C13H15N3O3S/c1-7-4-10(17)9(8(2)12(7)19-3)5-14-16-13-15-11(18)6-20-13/h4-5,17H,6H2,1-3H3,(H,15,16,18) |
| InChIKey | FXCNQOGKMWVZMF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|