C12H9BrF3N3O2S — CID 168574577
2-[[3-bromo-2-methoxy-6-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168574577) has the molecular formula C12H9BrF3N3O2S and a molecular weight of 396.19 g/mol. Its IUPAC name is 2-[[3-bromo-2-methoxy-6-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[3-bromo-2-methoxy-6-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168574577 |
| Molecular Formula | C12H9BrF3N3O2S |
| Molecular Weight | 396.19 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | 2-[[3-bromo-2-methoxy-6-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1c(Br)ccc(C(F)(F)F)c1C=NN=C1NC(=O)CS1 |
| InChI | InChI=1S/C12H9BrF3N3O2S/c1-21-10-6(4-17-19-11-18-9(20)5-22-11)7(12(14,15)16)2-3-8(10)13/h2-4H,5H2,1H3,(H,18,19,20) |
| InChIKey | FVDSBBXSSOQBSZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|