C11H6BrF4N3OS — CID 168575066
2-[[2-bromo-6-fluoro-3-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168575066) has the molecular formula C11H6BrF4N3OS and a molecular weight of 384.15 g/mol. Its IUPAC name is 2-[[2-bromo-6-fluoro-3-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[2-bromo-6-fluoro-3-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168575066 |
| Molecular Formula | C11H6BrF4N3OS |
| Molecular Weight | 384.15 g/mol |
| Exact Mass | 382.94 |
| IUPAC Name | 2-[[2-bromo-6-fluoro-3-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=NN=Cc2c(F)ccc(C(F)(F)F)c2Br)N1 |
| InChI | InChI=1S/C11H6BrF4N3OS/c12-9-5(3-17-19-10-18-8(20)4-21-10)7(13)2-1-6(9)11(14,15)16/h1-3H,4H2,(H,18,19,20) |
| InChIKey | KUMYQKABYUPOFH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.15 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|