C14H15N3O4S — CID 168573950
[2-methoxy-5-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]methyl acetate (PubChem CID 168573950) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is [2-methoxy-5-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]methyl acetate.
| Compound Name | [2-methoxy-5-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 168573950 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | [2-methoxy-5-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]methyl acetate |
| SMILES | COc1ccc(C=NN=C2NC(=O)CS2)cc1COC(C)=O |
| InChI | InChI=1S/C14H15N3O4S/c1-9(18)21-7-11-5-10(3-4-12(11)20-2)6-15-17-14-16-13(19)8-22-14/h3-6H,7-8H2,1-2H3,(H,16,17,19) |
| InChIKey | VZNAKVDGEQQBDD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|