C18H15F2N3O3S — CID 168576623
2-[[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168576623) has the molecular formula C18H15F2N3O3S and a molecular weight of 391.40 g/mol. Its IUPAC name is 2-[[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168576623 |
| Molecular Formula | C18H15F2N3O3S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2-[[3-[(2,4-difluorophenoxy)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C=NN=C2NC(=O)CS2)cc1COc1ccc(F)cc1F |
| InChI | InChI=1S/C18H15F2N3O3S/c1-25-15-4-2-11(8-21-23-18-22-17(24)10-27-18)6-12(15)9-26-16-5-3-13(19)7-14(16)20/h2-8H,9-10H2,1H3,(H,22,23,24) |
| InChIKey | JVUXUFCKMWNPKH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|