C14H13N3O3S — CID 168575083
methyl 3-[4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]prop-2-enoate (PubChem CID 168575083) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is methyl 3-[4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 168575083 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | methyl 3-[4-[[(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(C=NN=C2NC(=O)CS2)cc1 |
| InChI | InChI=1S/C14H13N3O3S/c1-20-13(19)7-6-10-2-4-11(5-3-10)8-15-17-14-16-12(18)9-21-14/h2-8H,9H2,1H3,(H,16,17,18) |
| InChIKey | JDNRXTMGJDUQQH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|