C21H14F3N5OS — CID 168577681
4-phenyl-N-[[2-[4-(trifluoromethyl)pyrimidin-2-yl]oxyphenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168577681) has the molecular formula C21H14F3N5OS and a molecular weight of 441.44 g/mol. Its IUPAC name is 4-phenyl-N-[[2-[4-(trifluoromethyl)pyrimidin-2-yl]oxyphenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-phenyl-N-[[2-[4-(trifluoromethyl)pyrimidin-2-yl]oxyphenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168577681 |
| Molecular Formula | C21H14F3N5OS |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 4-phenyl-N-[[2-[4-(trifluoromethyl)pyrimidin-2-yl]oxyphenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | FC(F)(F)c1ccnc(Oc2ccccc2C=NNc2nc(-c3ccccc3)cs2)n1 |
| InChI | InChI=1S/C21H14F3N5OS/c22-21(23,24)18-10-11-25-19(28-18)30-17-9-5-4-8-15(17)12-26-29-20-27-16(13-31-20)14-6-2-1-3-7-14/h1-13H,(H,27,29) |
| InChIKey | UCELDZIKFFKRGU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|