C24H29N5S — CID 168579308
N-[[2,5-dimethyl-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168579308) has the molecular formula C24H29N5S and a molecular weight of 419.60 g/mol. Its IUPAC name is N-[[2,5-dimethyl-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[[2,5-dimethyl-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168579308 |
| Molecular Formula | C24H29N5S |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-[[2,5-dimethyl-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Cc1cc(C=NNc2nc(-c3ccccc3)cs2)c(C)c(CN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C24H29N5S/c1-18-13-21(19(2)22(14-18)16-29-11-9-28(3)10-12-29)15-25-27-24-26-23(17-30-24)20-7-5-4-6-8-20/h4-8,13-15,17H,9-12,16H2,1-3H3,(H,26,27) |
| InChIKey | PNZAGDKUQJQNII-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|