About 4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile
4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 168587267) has the molecular formula C13H6Cl2F2N2O
and a molecular weight of 315.11 g/mol. Its IUPAC name is 4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| PubChem CID | 168587267 |
| Molecular Formula | C13H6Cl2F2N2O |
| Molecular Weight | 315.11 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2c(F)c(F)cc(Cl)c2Cl)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C13H6Cl2F2N2O/c1-5-2-6(7(4-18)13(20)19-5)10-11(15)8(14)3-9(16)12(10)17/h2-3H,1H3,(H,19,20) |
| InChIKey | RQVGSBZXQIAEDL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.11 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile?
The IUPAC name of 4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile (CID 168587267) is 4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile.
What is the SMILES notation for 4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile?
The canonical SMILES for 4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile is Cc1cc(-c2c(F)c(F)cc(Cl)c2Cl)c(C#N)c(=O)[nH]1.
What is the InChIKey of 4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile?
The InChIKey is RQVGSBZXQIAEDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6Cl2F2N2O/c1-5-2-6(7(4-18)13(20)19-5)10-11(15)8(14)3-9(16)12(10)17/h2-3H,1H3,(H,19,20).
What are the key properties of 4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile?
4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile has a molecular weight of 315.11 g/mol, XLogP of 3.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dichloro-5,6-difluorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile is sourced from PubChem (CID 168587267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).