C13H7Cl3N2O — CID 168586700
6-methyl-2-oxo-4-(2,3,6-trichlorophenyl)-1H-pyridine-3-carbonitrile (PubChem CID 168586700) has the molecular formula C13H7Cl3N2O and a molecular weight of 313.57 g/mol. Its IUPAC name is 6-methyl-2-oxo-4-(2,3,6-trichlorophenyl)-1H-pyridine-3-carbonitrile.
| Compound Name | 6-methyl-2-oxo-4-(2,3,6-trichlorophenyl)-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168586700 |
| Molecular Formula | C13H7Cl3N2O |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 6-methyl-2-oxo-4-(2,3,6-trichlorophenyl)-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2c(Cl)ccc(Cl)c2Cl)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C13H7Cl3N2O/c1-6-4-7(8(5-17)13(19)18-6)11-9(14)2-3-10(15)12(11)16/h2-4H,1H3,(H,18,19) |
| InChIKey | FLJKURJCOGXJFY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|