C19H12F3N3O2S — CID 168587816
4-[4-[(2,5-difluorophenyl)methoxy]-3-fluorophenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168587816) has the molecular formula C19H12F3N3O2S and a molecular weight of 403.39 g/mol. Its IUPAC name is 4-[4-[(2,5-difluorophenyl)methoxy]-3-fluorophenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-[4-[(2,5-difluorophenyl)methoxy]-3-fluorophenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168587816 |
| Molecular Formula | C19H12F3N3O2S |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 4-[4-[(2,5-difluorophenyl)methoxy]-3-fluorophenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccc(OCc3cc(F)ccc3F)c(F)c2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C19H12F3N3O2S/c1-28-19-24-17(13(8-23)18(26)25-19)10-2-5-16(15(22)7-10)27-9-11-6-12(20)3-4-14(11)21/h2-7H,9H2,1H3,(H,24,25,26) |
| InChIKey | MQZQUYUJHJXKDK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|