C19H13N3O3S — CID 168590388
2-[2-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl]benzoic acid (PubChem CID 168590388) has the molecular formula C19H13N3O3S and a molecular weight of 363.40 g/mol. Its IUPAC name is 2-[2-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl]benzoic acid.
| Compound Name | 2-[2-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 168590388 |
| Molecular Formula | C19H13N3O3S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-[2-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl]benzoic acid |
| SMILES | CSc1nc(-c2ccccc2-c2ccccc2C(=O)O)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C19H13N3O3S/c1-26-19-21-16(15(10-20)17(23)22-19)13-8-4-2-6-11(13)12-7-3-5-9-14(12)18(24)25/h2-9H,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | KZVFFXPSWUYNBW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|