C9H10ClN5O3 — CID 168591168
2-[[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]methylideneamino]guanidine (PubChem CID 168591168) has the molecular formula C9H10ClN5O3 and a molecular weight of 271.66 g/mol. Its IUPAC name is 2-[[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]methylideneamino]guanidine.
| Compound Name | 2-[[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168591168 |
| Molecular Formula | C9H10ClN5O3 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-[[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1cc([N+](=O)[O-])cc(CCl)c1O |
| InChI | InChI=1S/C9H10ClN5O3/c10-3-5-1-7(15(17)18)2-6(8(5)16)4-13-14-9(11)12/h1-2,4,16H,3H2,(H4,11,12,14) |
| InChIKey | YNZUTXDYOXXCER-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 140.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|