C17H19ClO5 — CID 168598190
5-[(4-butoxy-3-chlorophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168598190) has the molecular formula C17H19ClO5 and a molecular weight of 338.79 g/mol. Its IUPAC name is 5-[(4-butoxy-3-chlorophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(4-butoxy-3-chlorophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168598190 |
| Molecular Formula | C17H19ClO5 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 5-[(4-butoxy-3-chlorophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCCCOc1ccc(C=C2C(=O)OC(C)(C)OC2=O)cc1Cl |
| InChI | InChI=1S/C17H19ClO5/c1-4-5-8-21-14-7-6-11(10-13(14)18)9-12-15(19)22-17(2,3)23-16(12)20/h6-7,9-10H,4-5,8H2,1-3H3 |
| InChIKey | XGQZIUDGVDGUGJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|