C12H17N5O2 — CID 168603861
ethyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-3-methylbenzoate (PubChem CID 168603861) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is ethyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-3-methylbenzoate.
| Compound Name | ethyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 168603861 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | ethyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-3-methylbenzoate |
| SMILES | CCOC(=O)c1cccc(C)c1/N=C(/N)N=C(N)N |
| InChI | InChI=1S/C12H17N5O2/c1-3-19-10(18)8-6-4-5-7(2)9(8)16-12(15)17-11(13)14/h4-6H,3H2,1-2H3,(H6,13,14,15,16,17) |
| InChIKey | IEPDKZJNPRSGFK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|