C15H16ClN5O2 — CID 168604000
2-[4-(4-chlorophenoxy)-3-(hydroxymethyl)phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168604000) has the molecular formula C15H16ClN5O2 and a molecular weight of 333.78 g/mol. Its IUPAC name is 2-[4-(4-chlorophenoxy)-3-(hydroxymethyl)phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[4-(4-chlorophenoxy)-3-(hydroxymethyl)phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168604000 |
| Molecular Formula | C15H16ClN5O2 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-[4-(4-chlorophenoxy)-3-(hydroxymethyl)phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc(Oc2ccc(Cl)cc2)c(CO)c1 |
| InChI | InChI=1S/C15H16ClN5O2/c16-10-1-4-12(5-2-10)23-13-6-3-11(7-9(13)8-22)20-15(19)21-14(17)18/h1-7,22H,8H2,(H6,17,18,19,20,21) |
| InChIKey | IGUOVQZZGFYUTH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|