C11H13N9O2 — CID 168606054
2-[5-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]tetrazol-2-yl]acetic acid (PubChem CID 168606054) has the molecular formula C11H13N9O2 and a molecular weight of 303.29 g/mol. Its IUPAC name is 2-[5-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]tetrazol-2-yl]acetic acid.
| Compound Name | 2-[5-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]tetrazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 168606054 |
| Molecular Formula | C11H13N9O2 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-[5-[3-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]tetrazol-2-yl]acetic acid |
| SMILES | NC(N)=N/C(N)=N/c1cccc(-c2nnn(CC(=O)O)n2)c1 |
| InChI | InChI=1S/C11H13N9O2/c12-10(13)16-11(14)15-7-3-1-2-6(4-7)9-17-19-20(18-9)5-8(21)22/h1-4H,5H2,(H,21,22)(H6,12,13,14,15,16) |
| InChIKey | IEHWCRYOTOWKBR-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 183.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|